m-(propionamido)anilinodiethyl diacetate
Modify Date: 2025-09-28 00:28:56
m-(propionamido)anilinodiethyl diacetate structure
|
Common Name | m-(propionamido)anilinodiethyl diacetate | ||
|---|---|---|---|---|
| CAS Number | 24311-37-3 | Molecular Weight | 336.38300 | |
| Density | 1.188g/cm3 | Boiling Point | 521ºC at 760 mmHg | |
| Molecular Formula | C17H24N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 268.9ºC | |
| Name | 3-(6-chloro-3-methyl-1H-inden-2-yl)pyridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.188g/cm3 |
|---|---|
| Boiling Point | 521ºC at 760 mmHg |
| Molecular Formula | C17H24N2O5 |
| Molecular Weight | 336.38300 |
| Flash Point | 268.9ºC |
| Exact Mass | 336.16900 |
| PSA | 84.94000 |
| LogP | 2.04070 |
| Vapour Pressure | 5.92E-11mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | VFMLUXFDWFQZNA-UHFFFAOYSA-N |
| SMILES | CCC(=O)Nc1cccc(N(CCOC(C)=O)CCOC(C)=O)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Pyridine,3-(6-chloro-3-methylinden-2-yl) |
| 3-Propionylamido-N,N-bis(2-acetoxy-ethyl)-anilin |
| 3-(6-Chloro-3-methyl-2-indenyl)pyridine |
| SU-8000 |