1,2-Benzenedicarboxylicacid, 3,4,5,6-tetrachloro-, 1-butyl ester
Modify Date: 2025-08-26 01:40:00
1,2-Benzenedicarboxylicacid, 3,4,5,6-tetrachloro-, 1-butyl ester structure
|
Common Name | 1,2-Benzenedicarboxylicacid, 3,4,5,6-tetrachloro-, 1-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 24261-19-6 | Molecular Weight | 360.01700 | |
| Density | 1.517g/cm3 | Boiling Point | 462ºC at 760mmHg | |
| Molecular Formula | C12H10Cl4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.2ºC | |
| Name | 2-butoxycarbonyl-3,4,5,6-tetrachlorobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.517g/cm3 |
|---|---|
| Boiling Point | 462ºC at 760mmHg |
| Molecular Formula | C12H10Cl4O4 |
| Molecular Weight | 360.01700 |
| Flash Point | 233.2ºC |
| Exact Mass | 357.93300 |
| PSA | 63.60000 |
| LogP | 4.95530 |
| Vapour Pressure | 2.48E-09mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | WKYMTJULVAGWJM-UHFFFAOYSA-N |
| SMILES | CCCCOC(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1C(=O)O |
| HS Code | 2918990090 |
|---|
|
~%
1,2-Benzenedica... CAS#:24261-19-6 |
| Literature: Teterin; Sonis Zhurnal Obshchei Khimii, 1936 , vol. 6, p. 658,660 Chem. Zentralbl., 1936 , vol. 107, # II p. 2347 |
|
~%
1,2-Benzenedica... CAS#:24261-19-6 |
|
Literature: Monier,J. A. Diss. |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Butyl hydrogen tetrachlorophthalate |
| Phthalic acid,tetrachloro-,monobutyl ester |
| EINECS 246-112-5 |
| 2-(butoxycarbonyl)-3,4,5,6-tetrachlorobenzoic acid |
| 1,2-Benzenedicarboxylic acid,3,4,5,6-tetrachloro-,monobutyl ester |
| Monobutyl tetrachlorophthalate |
| tetrachloro-phthalic acid monobutyl ester |
| Tetrachlor-phthalsaeure-monobutylester |