1-cyclohexyl-3-(dimethylamino)-1-phenylpropan-1-ol structure
|
Common Name | 1-cyclohexyl-3-(dimethylamino)-1-phenylpropan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 24252-48-0 | Molecular Weight | 261.40200 | |
| Density | 1.019g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C17H27NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147ºC | |
| Name | 1-cyclohexyl-3-(dimethylamino)-1-phenylpropan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.019g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.40200 |
| Flash Point | 147ºC |
| Exact Mass | 261.20900 |
| PSA | 23.47000 |
| LogP | 3.40620 |
| Vapour Pressure | 9.2E-07mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | SMESLPMFLMRIHH-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(O)(c1ccccc1)C1CCCCC1 |
|
~%
1-cyclohexyl-3-... CAS#:24252-48-0 |
| Literature: Denton et al. Journal of the American Chemical Society, 1949 , vol. 71, p. 2050,2052 Journal of the American Chemical Society, 1950 , vol. 72, p. 3795 |
|
~%
1-cyclohexyl-3-... CAS#:24252-48-0 |
| Literature: Adamson et al. Journal of the Chemical Society, 1951 , p. 52,58 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 1-Phenyl-1-cyclohexyl-3-(dimethylamino)-1-propanol |
| 1-Cyclohexyl-2-methyl-3-dimethylamino-1-phenyl-propan-1-ol |
| Cyclohexane,1,4-bis((vinyloxy)methyl) |
| 3-Dimethylamino-1-phenyl-1-cyclohexyl-propanol-(1) |
| 1-cyclohexyl-3-dimethylamino-1-phenyl-propan-1-ol |