Benzenepropanamide, a-(benzoylamino)-
Modify Date: 2025-09-18 16:47:32
Benzenepropanamide, a-(benzoylamino)- structure
|
Common Name | Benzenepropanamide, a-(benzoylamino)- | ||
|---|---|---|---|---|
| CAS Number | 24250-72-4 | Molecular Weight | 268.31000 | |
| Density | 1.194g/cm3 | Boiling Point | 574.2ºC at 760mmHg | |
| Molecular Formula | C16H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 301ºC | |
| Name | N-(1-amino-1-oxo-3-phenylpropan-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 574.2ºC at 760mmHg |
| Molecular Formula | C16H16N2O2 |
| Molecular Weight | 268.31000 |
| Flash Point | 301ºC |
| Exact Mass | 268.12100 |
| PSA | 72.19000 |
| LogP | 2.60420 |
| Vapour Pressure | 3.46E-13mmHg at 25°C |
| Index of Refraction | 1.602 |
| InChIKey | GDJKEUNPXYLPHG-UHFFFAOYSA-N |
| SMILES | NC(=O)C(Cc1ccccc1)NC(=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
Benzenepropanam... CAS#:24250-72-4 |
| Literature: Bergmann; Fruton Journal of Biological Chemistry, 1938 , vol. 124, p. 321,328 |
|
~%
Benzenepropanam... CAS#:24250-72-4 |
| Literature: Bergmann; Fruton Journal of Biological Chemistry, 1938 , vol. 124, p. 321,328 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzoyl-phenylalanine amide |
| 3-Phenyl-2-benzamino-propionsaeureamid |
| N-Benzoyl-DL-phenylalanin-amid |
| Benzenepropanamide,a-(benzoylamino) |
| N-Benzoyl-phenylalanin-amid |
| DL-N-Benzoylphenylalaninamid |
| Benzoyl-dl-phenylalanin-amid |