TYMAZOLINE structure
|
Common Name | TYMAZOLINE | ||
|---|---|---|---|---|
| CAS Number | 24243-97-8 | Molecular Weight | 232.32100 | |
| Density | 1.08g/cm3 | Boiling Point | 413.4ºC at 760mmHg | |
| Molecular Formula | C14H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 203.8ºC | |
| Name | 2-[(5-methyl-2-propan-2-ylphenoxy)methyl]-4,5-dihydro-1H-imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 413.4ºC at 760mmHg |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.32100 |
| Flash Point | 203.8ºC |
| Exact Mass | 232.15800 |
| PSA | 33.62000 |
| LogP | 2.26330 |
| Vapour Pressure | 1.15E-06mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | QRORCRWSRPKEHR-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)c(OCC2=NCCN2)c1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Thymazen |
| Tymazoline |
| Tymazolin |
| Pernazene |