1-Propanone,1-(4-butoxyphenyl)-3-(dimethylamino)-, hydrochloride (1:1)
Modify Date: 2025-09-20 08:30:35
1-Propanone,1-(4-butoxyphenyl)-3-(dimethylamino)-, hydrochloride (1:1) structure
|
Common Name | 1-Propanone,1-(4-butoxyphenyl)-3-(dimethylamino)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 24239-62-1 | Molecular Weight | 285.81000 | |
| Density | 0.992g/cm3 | Boiling Point | 363.5ºC at 760 mmHg | |
| Molecular Formula | C15H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.6ºC | |
| Name | 1-(4-butoxyphenyl)-3-(dimethylamino)propan-1-one,hydrochloride |
|---|
| Density | 0.992g/cm3 |
|---|---|
| Boiling Point | 363.5ºC at 760 mmHg |
| Molecular Formula | C15H24ClNO2 |
| Molecular Weight | 285.81000 |
| Flash Point | 173.6ºC |
| Exact Mass | 285.15000 |
| PSA | 29.54000 |
| LogP | 3.80190 |
| Vapour Pressure | 1.8E-05mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | VGWJFXCVVGOPDU-UHFFFAOYSA-N |
| SMILES | CCCCOc1ccc(C(=O)CCN(C)C)cc1.Cl |
|
~%
1-Propanone,1-(... CAS#:24239-62-1 |
| Literature: Bockstahler; Wright Journal of the American Pharmaceutical Association (1912-1977), 1957 , vol. 46, p. 542,544 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |