2-Methyl-3-nitropyridine-6-carboxylic acid structure
|
Common Name | 2-Methyl-3-nitropyridine-6-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 24194-98-7 | Molecular Weight | 182.13400 | |
| Density | 1.477g/cm3 | Boiling Point | 365ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.5ºC | |
| Name | 6-methyl-5-nitropyridine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.477g/cm3 |
|---|---|
| Boiling Point | 365ºC at 760 mmHg |
| Molecular Formula | C7H6N2O4 |
| Molecular Weight | 182.13400 |
| Flash Point | 174.5ºC |
| Exact Mass | 182.03300 |
| PSA | 96.01000 |
| LogP | 1.51960 |
| Vapour Pressure | 5.72E-06mmHg at 25°C |
| Index of Refraction | 1.608 |
| InChIKey | MLRMGVGPJDXMLC-UHFFFAOYSA-N |
| SMILES | Cc1nc(C(=O)O)ccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~62%
2-Methyl-3-nitr... CAS#:24194-98-7 |
| Literature: Achremowicz, Lucjan Tetrahedron Letters, 1980 , vol. 21, p. 2433 - 2434 |
|
~%
2-Methyl-3-nitr... CAS#:24194-98-7 |
| Literature: Tetrahedron Letters, , vol. 21, p. 2433 - 2434 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-Nitro-2-methylpyridin-6-carbonsaeure |
| 6-Methyl-5-nitropyridin-2-carbonsaeure |
| 6-methyl-5-nitro-pyridine-2-carboxylic acid |
| 2-methyl-3-nitropyridine-6-carboxylic acid |
| 6-Methyl-5-nitropicolinic acid |
| 3-Nitro-2-methyl-6-pyridin-carbonsaeure |
| 3-Nitro-2-methyl-pyridin-carbonsaeure-(6) |