Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate
Modify Date: 2026-08-23 15:49:41
![Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate Structure](https://www.chemsrc.com/extcaspic/224/2418645-28-8.png)
Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate structure
|
Common Name | Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2418645-28-8 | Molecular Weight | 413.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24FN5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24FN5O4S |
|---|---|
| Molecular Weight | 413.5 |
| InChIKey | GYOVSLZJEHHQGX-UHFFFAOYSA-N |
| SMILES | Cc1c(CS(=O)(=O)F)cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1N=[N+]=[N-] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: Molecular weight of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is 413.5. |
| Q: What is the molecular formula of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: Molecular formula of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is C17H24FN5O4S. |
| Q: What is the InChIKey of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: InChIKey of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is GYOVSLZJEHHQGX-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: SMILES notation of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is Cc1c(CS(=O)(=O)F)cc(N2CCN(C(=O)OC(C)(C)C)CC2)cc1N=[N+]=[N-]. |
| Q: What is the Chinese name of 2418645-28-8? |
| A: Chinese name of 2418645-28-8 is 2418645-28-8. |
| Q: What is the English name of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: The English name of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate. |
| Q: What is the CAS number of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate? |
| A: CAS number of Tert-butyl 4-{3-azido-5-[(fluorosulfonyl)methyl]-4-methylphenyl}piperazine-1-carboxylate is 2418645-28-8. |