2-benzylsulfanyl-5-(trifluoromethyl)benzoic acid
Modify Date: 2025-08-25 16:10:20
2-benzylsulfanyl-5-(trifluoromethyl)benzoic acid structure
|
Common Name | 2-benzylsulfanyl-5-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 24156-14-7 | Molecular Weight | 312.30700 | |
| Density | 1.4g/cm3 | Boiling Point | 404.8ºC at 760mmHg | |
| Molecular Formula | C15H11F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | 2-benzylsulfanyl-5-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760mmHg |
| Molecular Formula | C15H11F3O2S |
| Molecular Weight | 312.30700 |
| Flash Point | 198.6ºC |
| Exact Mass | 312.04300 |
| PSA | 62.60000 |
| LogP | 4.69590 |
| Vapour Pressure | 2.81E-07mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | JJFQTKHGJJWAJZ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(C(F)(F)F)ccc1SCc1ccccc1 |
| HS Code | 2930909090 |
|---|
|
~%
2-benzylsulfany... CAS#:24156-14-7 |
| Literature: Lombardino,J.G.; Wiseman,E.H. Journal of Medicinal Chemistry, 1970 , vol. 13, p. 206 - 210 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-benzylthio-5-trifluoromethylbenzoic acid |
| 2-Benzylthio-5-trifluormethyl-benzoesaeure |
| BTBA |