trans-ccc_R08
Modify Date: 2025-08-24 11:25:08
trans-ccc_R08 structure
|
Common Name | trans-ccc_R08 | ||
|---|---|---|---|---|
| CAS Number | 2413192-49-9 | Molecular Weight | 414.84 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19ClO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of trans-ccc_R08trans-ccc_R08 (compound 1-B) is a potent cccDNA (covalently closed circular DMA) inhibitor. trans-ccc_R08 inhibits HBeAg level with an IC50 value of 0.08 µM. trans-ccc_R08 has the potential for the research of Hepatitis B Virus infection (HBV)[1]. |
| Name | trans-ccc_R08 |
|---|
| Description | trans-ccc_R08 (compound 1-B) is a potent cccDNA (covalently closed circular DMA) inhibitor. trans-ccc_R08 inhibits HBeAg level with an IC50 value of 0.08 µM. trans-ccc_R08 has the potential for the research of Hepatitis B Virus infection (HBV)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C22H19ClO6 |
|---|---|
| Molecular Weight | 414.84 |
| InChIKey | JFCQXBCQZCBQSI-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC(OCCOc2ccc(-c3cc(=O)c4cccc(Cl)c4o3)cc2)C1 |