9,10-Anthracenedione,1-amino-2-[4-(butylsulfonyl)phenoxy]-4-hydroxy- structure
|
Common Name | 9,10-Anthracenedione,1-amino-2-[4-(butylsulfonyl)phenoxy]-4-hydroxy- | ||
|---|---|---|---|---|
| CAS Number | 24108-92-7 | Molecular Weight | 451.49200 | |
| Density | 1.403g/cm3 | Boiling Point | 701.7ºC at 760mmHg | |
| Molecular Formula | C24H21NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.2ºC | |
| Name | 1-amino-2-(4-butylsulfonylphenoxy)-4-hydroxyanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.403g/cm3 |
|---|---|
| Boiling Point | 701.7ºC at 760mmHg |
| Molecular Formula | C24H21NO6S |
| Molecular Weight | 451.49200 |
| Flash Point | 378.2ºC |
| Exact Mass | 451.10900 |
| PSA | 132.14000 |
| LogP | 5.77790 |
| Vapour Pressure | 2.41E-20mmHg at 25°C |
| Index of Refraction | 1.653 |
| InChIKey | GSLQYSYCMSQUAE-UHFFFAOYSA-N |
| SMILES | CCCCS(=O)(=O)c1ccc(Oc2cc(O)c3c(c2N)C(=O)c2ccccc2C3=O)cc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Amino-2-[4-(Butylsulfonyl)phenoxy]-4-hydroxyanthracene-9,10-dione |