Tauroursodeoxycholic Acid-d4 MaxSpec® Standard structure
|
Common Name | Tauroursodeoxycholic Acid-d4 MaxSpec® Standard | ||
|---|---|---|---|---|
| CAS Number | 2410279-94-4 | Molecular Weight | 503.73 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H41D4NO6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tauroursodeoxycholic Acid-d4 MaxSpec® StandardTauroursodeoxycholate-d4 is deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. |
| Name | Tauroursodeoxycholic Acid-d4 MaxSpec® Standard |
|---|---|
| Synonym | More Synonyms |
| Description | Tauroursodeoxycholate-d4 is deuterium labeled Tauroursodeoxycholate. Tauroursodeoxycholate (Tauroursodeoxycholic acid) is an endoplasmic reticulum (ER) stress inhibitor. Tauroursodeoxycholate significantly reduces expression of apoptosis molecules, such as caspase-3 and caspase-12. Tauroursodeoxycholate also inhibits ERK. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H41D4NO6S |
| Molecular Weight | 503.73 |
| Exact Mass | 503.321869 |
| LogP | 2.10 |
| Index of Refraction | 1.552 |
| InChIKey | BHTRKEVKTKCXOH-RJPRAGLTSA-N |
| SMILES | CC(CCC(=O)NCCS(=O)(=O)O)C1CCC2C3C(O)CC4CC(O)CCC4(C)C3CCC12C |
| 2-{[(3α,5β,7β)-3,7-Dihydroxy-24-oxo(2,2,4,4-2H4)cholan-24-yl]amino}ethanesulfonic acid |
| Ethanesulfonic acid, 2-[[(3α,5β,7β)-3,7-dihydroxy-24-oxocholan-24-yl-2,2,4,4-d4]amino]- |