1-Amino-4-bromo-2-(hydroxymethyl)anthraquinone structure
|
Common Name | 1-Amino-4-bromo-2-(hydroxymethyl)anthraquinone | ||
|---|---|---|---|---|
| CAS Number | 24094-46-0 | Molecular Weight | 332.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H10BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-amino-4-bromo-2-(hydroxymethyl)anthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H10BrNO3 |
|---|---|
| Molecular Weight | 332.14900 |
| Exact Mass | 330.98400 |
| PSA | 80.39000 |
| LogP | 2.88020 |
| InChIKey | VACUZNZYZQMQTD-UHFFFAOYSA-N |
| SMILES | Nc1c(CO)cc(Br)c2c1C(=O)c1ccccc1C2=O |
| HS Code | 2922509090 |
|---|
|
~%
1-Amino-4-bromo... CAS#:24094-46-0 |
| Literature: Metwally, Saoud A. M.; Youssef, Mohamed S. K.; Younes, Mansour I. Bulletin of the Chemical Society of Japan, 1980 , vol. 53, # 10 p. 3007 - 3011 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1-Amino-4-bromo-2-(hydroxymethyl)anthra-9,10-quinone |
| 9,10-Anthracenedione,1-amino-4-bromo-2-(hydroxymethyl) |
| 1-Amino-4-bromo-2-(hydroxymethyl)anthraquinone |
| 1-Amino-4-brom-2-(hydroxymethyl)anthrachinon |