Vamagloxistat
Modify Date: 2025-09-03 19:02:26
Vamagloxistat structure
|
Common Name | Vamagloxistat | ||
|---|---|---|---|---|
| CAS Number | 2408241-62-1 | Molecular Weight | 371.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H15F2N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VamagloxistatVamagloxistat is glycolate oxidase inhibitor, used to inhibit hyperoxaluria and kidney stones[1]. |
| Name | Vamagloxistat |
|---|
| Description | Vamagloxistat is glycolate oxidase inhibitor, used to inhibit hyperoxaluria and kidney stones[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C19H15F2N3O3 |
|---|---|
| Molecular Weight | 371.34 |
| InChIKey | DIQJDWGODFNEHC-UHFFFAOYSA-N |
| SMILES | O=C(O)c1[nH]nnc1Oc1ccc(-c2ccc(C3CC(F)(F)C3)cc2)cc1 |