FM26
Modify Date: 2025-08-20 12:19:32
FM26 structure
|
Common Name | FM26 | ||
|---|---|---|---|---|
| CAS Number | 2407981-35-3 | Molecular Weight | 461.82 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H15ClF3N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of FM26FM26 (compound 25) is a potent and allosteric retinoic acid receptor-related orphan receptor γt (RORγt) inverse agonists with an IC50 of 264 nM. FM26 has a distinct isoxazole chemotype and effectively reduces IL-17a mRNA production in EL4 cells[1]. |
| Name | FM26 |
|---|
| Description | FM26 (compound 25) is a potent and allosteric retinoic acid receptor-related orphan receptor γt (RORγt) inverse agonists with an IC50 of 264 nM. FM26 has a distinct isoxazole chemotype and effectively reduces IL-17a mRNA production in EL4 cells[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 264 nM (RORγt)[1] |
| In Vitro | FM26 (compound 25; 10 μM, 24h) significantly reduces IL-17a mRNA expression 27-fold in EL4 cells[1]. |
| References |
| Molecular Formula | C22H15ClF3N3O3 |
|---|---|
| Molecular Weight | 461.82 |
| InChIKey | KGEONJPJJNFHOI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NCc2c(-c3c(Cl)cccc3C(F)(F)F)noc2-c2cc[nH]c2)cc1 |