2-Cyclohexene-1-carboxylicacid, 2-methyl-6-(1-methylethyl)-4-oxo-, ethyl ester structure
|
Common Name | 2-Cyclohexene-1-carboxylicacid, 2-methyl-6-(1-methylethyl)-4-oxo-, ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 24079-95-6 | Molecular Weight | 224.29600 | |
| Density | 1.017g/cm3 | Boiling Point | 308.3ºC at 760mmHg | |
| Molecular Formula | C13H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 131.5ºC | |
| Name | ethyl 2-methyl-4-oxo-6-propan-2-ylcyclohex-2-ene-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.017g/cm3 |
|---|---|
| Boiling Point | 308.3ºC at 760mmHg |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.29600 |
| Flash Point | 131.5ºC |
| Exact Mass | 224.14100 |
| PSA | 43.37000 |
| LogP | 2.35700 |
| Vapour Pressure | 0.000685mmHg at 25°C |
| Index of Refraction | 1.47 |
| InChIKey | QBMOPULUXAKJTR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1C(C)=CC(=O)CC1C(C)C |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Methyl-6-(1-methylethyl)-4-oxo-2-cyclohexen-1-carbonsaeure-ethylester |
| (+-)-Ethyl-5-oxo-m-menth-6-en-2-carboxylat |
| ethyl 2-methyl-4-oxo-6-(propan-2-yl)cyclohex-2-ene-1-carboxylate |
| ethyl 6-(isopropyl)-2-methyl-4-oxocyclohex-2-ene-1-carboxylate |
| 6-isopropyl-2-methyl-4-oxo-cyclohex-2-enecarboxylic acid ethyl ester |
| 3-Methyl-5-isopropyl-4-carbethoxy-2-cyclohexene-1-one |
| 6-Isopropyl-2-methyl-4-oxo-cyclohex-2-encarbonsaeure-aethylester |
| EINECS 246-010-0 |
| BB_NC-0301 |