Lipoamido-PEG12-carboxylic Acid
Modify Date: 2025-08-22 21:25:52
Lipoamido-PEG12-carboxylic Acid structure
|
Common Name | Lipoamido-PEG12-carboxylic Acid | ||
|---|---|---|---|---|
| CAS Number | 2407442-47-9 | Molecular Weight | 806.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C35H67NO15S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Lipoamido-PEG12-carboxylic AcidLipoamido-PEG12-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Lipoamido-PEG12-acid |
|---|
| Description | Lipoamido-PEG12-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C35H67NO15S2 |
|---|---|
| Molecular Weight | 806.03 |
| InChIKey | KTDABPXYRAJNFQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCCC1CCSS1 |
| Storage condition | 2-8℃ |