4,5-dihydroxycyclohexane-1,2-dicarboxylic acid
Modify Date: 2025-09-15 10:59:02
4,5-dihydroxycyclohexane-1,2-dicarboxylic acid structure
|
Common Name | 4,5-dihydroxycyclohexane-1,2-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2403-25-0 | Molecular Weight | 204.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H12O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4,5-dihydroxycyclohexane-1,2-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H12O6 |
|---|---|
| Molecular Weight | 204.17700 |
| Exact Mass | 204.06300 |
| PSA | 115.06000 |
| InChIKey | IMRVRTDYOOJNHM-UHFFFAOYSA-N |
| SMILES | O=C(O)C1CC(O)C(O)CC1C(=O)O |
| HS Code | 2918199090 |
|---|
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 4,5-Diol-cyclohexan-1,2-dicarbonsaeure |
| 1,2-Cyclohexanedicarboxylic acid,4,5-dihydroxy |
| 4,5-Dihydroxy-hexahydrophthalsaeure |