Benzeneacetic acid, 3-benzoyl-alpha-methyl-, compd. with N-cyclohexylcyclohexanamine (1:1) structure
|
Common Name | Benzeneacetic acid, 3-benzoyl-alpha-methyl-, compd. with N-cyclohexylcyclohexanamine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 24021-57-6 | Molecular Weight | 435.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H37NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Benzeneacetic acid, 3-benzoyl-alpha-methyl-, compd. with N-cyclohexylcyclohexanamine (1:1) |
|---|
| Molecular Formula | C28H37NO3 |
|---|---|
| Molecular Weight | 435.6 |
| InChIKey | KHJFVODDOZJDPV-UHFFFAOYSA-N |
| SMILES | C1CCC(NC2CCCCC2)CC1.CC(C(=O)O)c1cccc(C(=O)c2ccccc2)c1 |