Desmethyl Ketoprofen Methyl Ester structure
|
Common Name | Desmethyl Ketoprofen Methyl Ester | ||
|---|---|---|---|---|
| CAS Number | 24021-44-1 | Molecular Weight | 254.28100 | |
| Density | 1.139g/cm3 | Boiling Point | 409.9ºC at 760 mmHg | |
| Molecular Formula | C16H14O3 | Melting Point | 103-105ºC | |
| MSDS | N/A | Flash Point | 182.4ºC | |
| Name | methyl 2-(3-benzoylphenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 409.9ºC at 760 mmHg |
| Melting Point | 103-105ºC |
| Molecular Formula | C16H14O3 |
| Molecular Weight | 254.28100 |
| Flash Point | 182.4ºC |
| Exact Mass | 254.09400 |
| PSA | 43.37000 |
| LogP | 2.63310 |
| Vapour Pressure | 6.28E-07mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | QTXILVCSTXQKLF-UHFFFAOYSA-N |
| SMILES | COC(=O)Cc1cccc(C(=O)c2ccccc2)c1 |
| HS Code | 2918300090 |
|---|
|
~%
Desmethyl Ketop... CAS#:24021-44-1 |
| Literature: US3931302 A1, ; |
|
~82%
Desmethyl Ketop... CAS#:24021-44-1 |
| Literature: Cosa, Gonzalo; Llauger, Laura; Scaiano; Miranda, Miguel A Organic letters, 2002 , vol. 4, # 18 p. 3083 - 3085 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Benzeneacetic acid,3-benzoyl-,methyl ester |
| methyl m-benzoyl-phenyl-acetate |
| Methyl (3-Benzoylphenyl)acetate |
| 3-Benzoyl-benzeneacetic Acid Methyl Ester |
| Desmethyl Ketoprofen Methyl Ester |
| (3-Benzoyl-phenyl)-essigsaeuremethylester |
| (m-Benzoylphenyl)acetic Acid Methyl Ester |