1,3-dioxo-2-pyridin-3-ylisoindole-5-carboxylic acid structure
|
Common Name | 1,3-dioxo-2-pyridin-3-ylisoindole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 239807-67-1 | Molecular Weight | 268.22400 | |
| Density | 1.554g/cm3 | Boiling Point | 557.6ºC at 760 mmHg | |
| Molecular Formula | C14H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291ºC | |
| Name | 1,3-dioxo-2-pyridin-3-ylisoindole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.554g/cm3 |
|---|---|
| Boiling Point | 557.6ºC at 760 mmHg |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Flash Point | 291ºC |
| Exact Mass | 268.04800 |
| PSA | 87.57000 |
| LogP | 1.64540 |
| Vapour Pressure | 2.88E-13mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | GBXDDZNYIUMDCM-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2c(c1)C(=O)N(c1cccnc1)C2=O |
| HS Code | 2925190090 |
|---|
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| bb_sc-8270 |