1-(3-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione
Modify Date: 2025-09-27 12:47:10
1-(3-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione structure
|
Common Name | 1-(3-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione | ||
|---|---|---|---|---|
| CAS Number | 23975-63-5 | Molecular Weight | 295.053 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 307.8±42.0 °C at 760 mmHg | |
| Molecular Formula | C10H6BrF3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.9±27.9 °C | |
| Name | 1-(2-bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 307.8±42.0 °C at 760 mmHg |
| Molecular Formula | C10H6BrF3O2 |
| Molecular Weight | 295.053 |
| Flash Point | 139.9±27.9 °C |
| Exact Mass | 293.950317 |
| PSA | 34.14000 |
| LogP | 5.08 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.497 |
| InChIKey | GOHPFCXEXBKPLP-UHFFFAOYSA-N |
| SMILES | O=C(CC(=O)C(F)(F)F)c1ccccc1Br |
| HS Code | 2914700090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-(3-Bromophenyl)-4,4,4-trifluorobutane-1,3-dione |
| 2-bromophenyl-4,4,4-trifluorobutane-1,3-dione |
| 1,3-Butanedione, 1-(3-bromophenyl)-4,4,4-trifluoro- |
| 1-(3-Bromophenyl)-4,4,4-trifluoro-1,3-butanedione |