3,5-diiodo-4-propoxybenzohydrazide
Modify Date: 2025-09-15 08:30:47
3,5-diiodo-4-propoxybenzohydrazide structure
|
Common Name | 3,5-diiodo-4-propoxybenzohydrazide | ||
|---|---|---|---|---|
| CAS Number | 23964-40-1 | Molecular Weight | 446.02300 | |
| Density | 2.044g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C10H12I2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,5-diiodo-4-propoxybenzohydrazide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.044g/cm3 |
|---|---|
| Molecular Formula | C10H12I2N2O2 |
| Molecular Weight | 446.02300 |
| Exact Mass | 445.89900 |
| PSA | 67.84000 |
| LogP | 3.56320 |
| Index of Refraction | 1.66 |
| InChIKey | BLVQCQRDSUWDOU-UHFFFAOYSA-N |
| SMILES | CCCOc1c(I)cc(C(=O)NN)cc1I |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 3,5-Diiodo-4-propoxybenzoic acid hydrazide |
| Benzoic acid,3,5-diiodo-4-propoxy-,hydrazide |