2,4(1H,3H)-Pyrimidinedione,5-(2-hydroxyethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-(2-hydroxyethyl)- | ||
|---|---|---|---|---|
| CAS Number | 23956-12-9 | Molecular Weight | 156.13900 | |
| Density | 1.324 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(2-Hydroxyethyl)pyrimidine-2,4(1H,3H)-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324 g/cm3 |
|---|---|
| Molecular Formula | C6H8N2O3 |
| Molecular Weight | 156.13900 |
| Exact Mass | 156.05300 |
| PSA | 85.95000 |
| Index of Refraction | 1.52 |
| InChIKey | WVOOACKBYPVACH-UHFFFAOYSA-N |
| SMILES | O=c1[nH]cc(CCO)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-(2-hydroxyethyl)-1H-pyrimidine-2,4-dione |