4,6-dichloro-N-(3-(trifluoromethyl)phenyl)-1,3,5- structure
|
Common Name | 4,6-dichloro-N-(3-(trifluoromethyl)phenyl)-1,3,5- | ||
|---|---|---|---|---|
| CAS Number | 2394-87-8 | Molecular Weight | 309.07500 | |
| Density | 1.605g/cm3 | Boiling Point | 425.5ºC at 760 mmHg | |
| Molecular Formula | C10H5Cl2F3N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.1ºC | |
| Name | 4,6-dichloro-N-[3-(trifluoromethyl)phenyl]-1,3,5-triazin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.605g/cm3 |
|---|---|
| Boiling Point | 425.5ºC at 760 mmHg |
| Molecular Formula | C10H5Cl2F3N4 |
| Molecular Weight | 309.07500 |
| Flash Point | 211.1ºC |
| Exact Mass | 307.98400 |
| PSA | 50.70000 |
| LogP | 4.01380 |
| Vapour Pressure | 1.91E-07mmHg at 25°C |
| Index of Refraction | 1.586 |
| InChIKey | FAFZIJKMZUBDSO-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(Nc2nc(Cl)nc(Cl)n2)c1 |
| HS Code | 2933699090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 4,6-dichloro-N-(3-(trifluoromethyl)phenyl)-1,3,5-triazin-2-amine |
| n2-[3-(trifluoromethyl)phenyl]-4,6-dichloro-1,3,5-triazin-2-amine |
| (4,6-dichloro-[1,3,5]triazin-2-yl)-(3-trifluoromethyl-phenyl)-amine |