1-Propanone,3-(dimethylamino)-1-(2,5-dimethylphenyl)-, hydrochloride (1:1)
Modify Date: 2025-08-25 18:55:31
1-Propanone,3-(dimethylamino)-1-(2,5-dimethylphenyl)-, hydrochloride (1:1) structure
|
Common Name | 1-Propanone,3-(dimethylamino)-1-(2,5-dimethylphenyl)-, hydrochloride (1:1) | ||
|---|---|---|---|---|
| CAS Number | 23935-13-9 | Molecular Weight | 241.75700 | |
| Density | 0.976g/cm3 | Boiling Point | 309.1ºC at 760mmHg | |
| Molecular Formula | C13H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106ºC | |
| Name | 3-(dimethylamino)-1-(2,5-dimethylphenyl)propan-1-one,hydrochloride |
|---|
| Density | 0.976g/cm3 |
|---|---|
| Boiling Point | 309.1ºC at 760mmHg |
| Molecular Formula | C13H20ClNO |
| Molecular Weight | 241.75700 |
| Flash Point | 106ºC |
| Exact Mass | 241.12300 |
| PSA | 20.31000 |
| LogP | 3.23980 |
| Vapour Pressure | 0.000652mmHg at 25°C |
| Index of Refraction | 1.516 |
| InChIKey | SAVRKVIJSVUDJX-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(C(=O)CCN(C)C)c1.Cl |
|
~%
1-Propanone,3-(... CAS#:23935-13-9 |
| Literature: Dimmock, Jonathan R.; Patil, Shirish A.; Leek, Donald M.; Warrington, Robert C.; Fang, Wei D. European Journal of Medicinal Chemistry, 1987 , vol. 22, p. 545 - 552 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |