5,6-Dimethoxy-N,N-dimethyl-2-naphthalenamine
Modify Date: 2024-04-02 08:59:08
5,6-Dimethoxy-N,N-dimethyl-2-naphthalenamine structure
|
Common Name | 5,6-Dimethoxy-N,N-dimethyl-2-naphthalenamine | ||
|---|---|---|---|---|
| CAS Number | 23923-03-7 | Molecular Weight | 231.29000 | |
| Density | 1.103g/cm3 | Boiling Point | 332.2ºC at 760mmHg | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 117.1ºC | |
| Name | 5,6-dimethoxy-N,N-dimethylnaphthalen-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.103g/cm3 |
|---|---|
| Boiling Point | 332.2ºC at 760mmHg |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29000 |
| Flash Point | 117.1ºC |
| Exact Mass | 231.12600 |
| PSA | 21.70000 |
| LogP | 2.92300 |
| Vapour Pressure | 0.000149mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | KUAGFDUGAXZTOU-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(N(C)C)cccc2c1OC |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-NAPHTHYLAMINE,5,6-DIMETHOXY-N,N-DIMETHYL |
| 5,6-Dimethoxy-N,N-dimethyl-2-naphthylamine |
| 2-Dimethylamino-5,6-dimethoxy-naphthalin |
| 2-Dimethylamino-5,6-dimethoxynaphthalene |