6-amino-1-fluoroanthracene-9,10-dione structure
|
Common Name | 6-amino-1-fluoroanthracene-9,10-dione | ||
|---|---|---|---|---|
| CAS Number | 2392-33-8 | Molecular Weight | 241.21700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H8FNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-amino-1-fluoroanthracene-9,10-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H8FNO2 |
|---|---|
| Molecular Weight | 241.21700 |
| Exact Mass | 241.05400 |
| PSA | 60.16000 |
| LogP | 2.76450 |
| InChIKey | VHVXRMJVQGGQAX-UHFFFAOYSA-N |
| SMILES | Nc1ccc2c(c1)C(=O)c1cccc(F)c1C2=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-Fluor-2-amino-anthrachinon |
| 2-Amino-5-fluor-9,10-anthrachinon |
| 9,10-Anthracenedione,6-amino-1-fluoro |