(-)-2,3-dimethylbutane-1,2,3-tricarboxylic acid structure
|
Common Name | (-)-2,3-dimethylbutane-1,2,3-tricarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2385-74-2 | Molecular Weight | 218.20400 | |
| Density | 1.354g/cm3 | Boiling Point | 291.5ºC at 760 mmHg | |
| Molecular Formula | C9H14O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.3ºC | |
| Name | 2,3-dimethylbutane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.354g/cm3 |
|---|---|
| Boiling Point | 291.5ºC at 760 mmHg |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20400 |
| Flash Point | 144.3ºC |
| Exact Mass | 218.07900 |
| PSA | 111.90000 |
| LogP | 0.66280 |
| Vapour Pressure | 0.000483mmHg at 25°C |
| Index of Refraction | 1.512 |
| InChIKey | MJCJFUJXVGIUOD-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)C(C)(CC(=O)O)C(=O)O |
| HS Code | 2917190090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2,3-Dimethyl-butan-1,2,3-tricarbonsaeure |
| EINECS 219-192-4 |
| camphoronic acid |
| Camphoronsaeure |
| (-)-2,3-Dimethylbutane-1,2,3-tricarboxylic acid |