N-(4-bromophenyl)-2-nitrobenzamide structure
|
Common Name | N-(4-bromophenyl)-2-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 2385-26-4 | Molecular Weight | 321.12600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-bromophenyl)-2-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H9BrN2O3 |
|---|---|
| Molecular Weight | 321.12600 |
| Exact Mass | 319.98000 |
| PSA | 74.92000 |
| LogP | 4.20580 |
| InChIKey | DWXXIIAUWRLEPK-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(Br)cc1)c1ccccc1[N+](=O)[O-] |
| HS Code | 2924299090 |
|---|
|
~%
N-(4-bromopheny... CAS#:2385-26-4 |
| Literature: Wang, Huamin; Cao, Xiangxiang; Xiao, Fuhong; Liu, Saiwen; Deng, Guo-Jun Organic Letters, 2013 , vol. 15, # 18 p. 4900 - 4903 |
|
~45%
N-(4-bromopheny... CAS#:2385-26-4 |
| Literature: Gao, Jie; Wang, Guan-Wu Journal of Organic Chemistry, 2008 , vol. 73, # 7 p. 2955 - 2958 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Nitro-benzoesaeure-<4-brom-anilid>CTK0I7732 |
| 2-Nitro-benzoesaeure-(4-brom-anilid) |
| 2-nitro-benzoic acid-(4-bromo-anilide) |
| 2-Nitro-4'-brom-benzanilid |
| N1-(4-bromophenyl)-2-nitrobenzamide |
| 2-nitro-N-(4-bromophenyl)benzamide |