S-(-)-Alprenolol
Modify Date: 2025-09-27 22:01:39
S-(-)-Alprenolol structure
|
Common Name | S-(-)-Alprenolol | ||
|---|---|---|---|---|
| CAS Number | 23846-71-1 | Molecular Weight | 249.34900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of S-(-)-Alprenolol(S)-Alprenolol is a potent and nonselective β-blocker[1]. |
| Name | [3H]-Alprenolol |
|---|
| Description | (S)-Alprenolol is a potent and nonselective β-blocker[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H23NO2 |
|---|---|
| Molecular Weight | 249.34900 |
| Exact Mass | 249.17300 |
| PSA | 41.49000 |
| LogP | 2.54370 |
| InChIKey | PAZJSJFMUHDSTF-AWEZNQCLSA-N |
| SMILES | C=CCc1ccccc1OCC(O)CNC(C)C |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |