FMOC-L-SS-HOMO-VAL-OH
Modify Date: 2025-11-25 12:00:37
FMOC-L-SS-HOMO-VAL-OH structure
|
Common Name | FMOC-L-SS-HOMO-VAL-OH | ||
|---|---|---|---|---|
| CAS Number | 23838-75-7 | Molecular Weight | 255.35500 | |
| Density | 1.04g/cm3 | Boiling Point | 354.7ºC at 760 mmHg | |
| Molecular Formula | C17H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 156.3ºC | |
| Name | 2-[4-(tert-Pentyl)phenoxy]phenylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 354.7ºC at 760 mmHg |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.35500 |
| Flash Point | 156.3ºC |
| Exact Mass | 255.16200 |
| PSA | 35.25000 |
| LogP | 5.32990 |
| Vapour Pressure | 3.28E-05mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | ZPAKZPXFBJPSBQ-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(Oc2ccccc2N)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Einecs 245-903-2 |