N-(2,4-Dichlorophenyl)-2-imidazoline-2-amine structure
|
Common Name | N-(2,4-Dichlorophenyl)-2-imidazoline-2-amine | ||
|---|---|---|---|---|
| CAS Number | 23830-88-8 | Molecular Weight | 658.75000 | |
| Density | 1.5g/cm3 | Boiling Point | 324.2ºC at 760mmHg | |
| Molecular Formula | C40H34N8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 149.9ºC | |
| Name | 1-[4-[4-(3,5-diphenyl-2H-tetrazol-1-yl)-3-methoxyphenyl]-2-methoxyphenyl]-3,5-diphenyl-2H-tetrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Boiling Point | 324.2ºC at 760mmHg |
| Molecular Formula | C40H34N8O2 |
| Molecular Weight | 658.75000 |
| Flash Point | 149.9ºC |
| Exact Mass | 658.28000 |
| PSA | 80.20000 |
| LogP | 7.37560 |
| Vapour Pressure | 0.000249mmHg at 25°C |
| Index of Refraction | 1.67 |
| InChIKey | OLHBOWPZHXCUNR-UHFFFAOYSA-N |
| SMILES | Clc1ccc(NC2=NCCN2)c(Cl)c1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 245-567-7 |
| 1,1'-(3,3'-dimethoxybiphenyl-4,4'-diyl)bis(3,5-diphenyl-2,3-dihydro-1h-tetrazole) |
| 2-(2,4-dichlorophenylimino)imidazolidine |
| 1,1'-(3,3'-Dimethoxy-4,4'-biphenylylene)bis(3,5-diphenylformazane) |
| (2,4-dichloro-phenyl)-(4,5-dihydro-1H-imidazol-2-yl)-amine |