2-[2-(2-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid
Modify Date: 2025-09-24 20:56:11
![2-[2-(2-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid Structure](https://image.chemsrc.com/caspic/062/23821-79-6.png)
2-[2-(2-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid structure
|
Common Name | 2-[2-(2-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid | ||
|---|---|---|---|---|
| CAS Number | 23821-79-6 | Molecular Weight | 329.80100 | |
| Density | 1.362g/cm3 | Boiling Point | 561.9ºC at 760 mmHg | |
| Molecular Formula | C17H12ClNO2S | Melting Point | 174-176ºC | |
| MSDS | N/A | Flash Point | 293.6ºC | |
| Name | 2-[2-(2-chlorophenyl)-4-phenyl-1,3-thiazol-5-yl]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.362g/cm3 |
|---|---|
| Boiling Point | 561.9ºC at 760 mmHg |
| Melting Point | 174-176ºC |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.80100 |
| Flash Point | 293.6ºC |
| Exact Mass | 329.02800 |
| PSA | 78.43000 |
| LogP | 4.75760 |
| Vapour Pressure | 1.84E-13mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | GJKWJSNKAHQBMK-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1sc(-c2ccccc2Cl)nc1-c1ccccc1 |
| HS Code | 2934100090 |
|---|
|
~%
2-[2-(2-chlorop... CAS#:23821-79-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 17, p. 1177 - 1181 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| [2-(2-chloro-phenyl)-4-phenyl-thiazol-5-yl]-acetic acid |
| 2-(2-chlorophenyl)-4-phenylthiazole-5-acetic acid |
| HMS2606N03 |