3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile
Modify Date: 2025-09-06 13:00:44
amino}azetidin-1-yl)pyrazine-2-carbonitrile Structure](https://www.chemsrc.com/extcaspic/400/2380098-62-2.png)
3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile structure
|
Common Name | 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 2380098-62-2 | Molecular Weight | 348.2 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15Cl2N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15Cl2N5 |
|---|---|
| Molecular Weight | 348.2 |
| InChIKey | GKWJOPFZIQMEPU-UHFFFAOYSA-N |
| SMILES | CN(Cc1ccc(Cl)cc1Cl)C1CN(c2nccnc2C#N)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: InChIKey of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is GKWJOPFZIQMEPU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: SMILES notation of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is CN(Cc1ccc(Cl)cc1Cl)C1CN(c2nccnc2C#N)C1. |
| Q: What is the Chinese name of 2380098-62-2? |
| A: Chinese name of 2380098-62-2 is 2380098-62-2. |
| Q: What is the molecular weight of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: Molecular weight of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is 348.2. |
| Q: What is the English name of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: The English name of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile. |
| Q: What is the molecular formula of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: Molecular formula of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is C16H15Cl2N5. |
| Q: What is the CAS number of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile? |
| A: CAS number of 3-(3-{[(2,4-Dichlorophenyl)methyl](methyl)amino}azetidin-1-yl)pyrazine-2-carbonitrile is 2380098-62-2. |