CID 145867985
Modify Date: 2026-08-22 06:28:45
CID 145867985 structure
|
Common Name | CID 145867985 | ||
|---|---|---|---|---|
| CAS Number | 2380098-32-6 | Molecular Weight | 246.13 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 145867985 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13Cl2N3 |
|---|---|
| Molecular Weight | 246.13 |
| InChIKey | CZKMOICAVMZEQV-UHFFFAOYSA-N |
| SMILES | Cl.Cl.c1ccc2c(c1)ncn2C1CNC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 145867985? |
| A: The English name of CID 145867985 is CID 145867985. |
| Q: What is the Chinese name of 2380098-32-6? |
| A: Chinese name of 2380098-32-6 is 2380098-32-6. |
| Q: What is the CAS number of CID 145867985? |
| A: CAS number of CID 145867985 is 2380098-32-6. |
| Q: What is the SMILES notation of CID 145867985? |
| A: SMILES notation of CID 145867985 is Cl.Cl.c1ccc2c(c1)ncn2C1CNC1. |
| Q: What is the molecular formula of CID 145867985? |
| A: Molecular formula of CID 145867985 is C10H13Cl2N3. |
| Q: What is the molecular weight of CID 145867985? |
| A: Molecular weight of CID 145867985 is 246.13. |
| Q: What is the InChIKey of CID 145867985? |
| A: InChIKey of CID 145867985 is CZKMOICAVMZEQV-UHFFFAOYSA-N. |