1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea
Modify Date: 2026-07-07 13:22:40
![1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea Structure](https://www.chemsrc.com/extcaspic/462/2380098-29-1.png)
1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea structure
|
Common Name | 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea | ||
|---|---|---|---|---|
| CAS Number | 2380098-29-1 | Molecular Weight | 353.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H24FN3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H24FN3O2S |
|---|---|
| Molecular Weight | 353.5 |
| InChIKey | BVYAOIWMYZHYEU-UHFFFAOYSA-N |
| SMILES | O=C(NCC1(N2CCOCC2)CCSCC1)Nc1ccccc1F |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 2380098-29-1? |
| A: Chinese name of 2380098-29-1 is 2380098-29-1. |
| Q: What is the molecular weight of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: Molecular weight of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is 353.5. |
| Q: What is the SMILES notation of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: SMILES notation of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is O=C(NCC1(N2CCOCC2)CCSCC1)Nc1ccccc1F. |
| Q: What is the InChIKey of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: InChIKey of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is BVYAOIWMYZHYEU-UHFFFAOYSA-N. |
| Q: What is the CAS number of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: CAS number of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is 2380098-29-1. |
| Q: What is the molecular formula of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: Molecular formula of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is C17H24FN3O2S. |
| Q: What is the English name of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea? |
| A: The English name of 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea is 1-(2-Fluorophenyl)-3-{[4-(morpholin-4-yl)thian-4-yl]methyl}urea. |