4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine
Modify Date: 2026-08-12 08:15:19
![4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine Structure](https://www.chemsrc.com/extcaspic/483/2380098-11-1.png)
4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine structure
|
Common Name | 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 2380098-11-1 | Molecular Weight | 284.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H20N4O |
|---|---|
| Molecular Weight | 284.36 |
| InChIKey | TYCKIPGMGITCQH-UHFFFAOYSA-N |
| SMILES | Cc1ccnc(N2CCCC(COc3ccncc3)C2)n1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: InChIKey of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is TYCKIPGMGITCQH-UHFFFAOYSA-N. |
| Q: What is the English name of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: The English name of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine. |
| Q: What is the molecular formula of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: Molecular formula of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is C16H20N4O. |
| Q: What is the Chinese name of 2380098-11-1? |
| A: Chinese name of 2380098-11-1 is 2380098-11-1. |
| Q: What is the CAS number of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: CAS number of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is 2380098-11-1. |
| Q: What is the molecular weight of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: Molecular weight of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is 284.36. |
| Q: What is the SMILES notation of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine? |
| A: SMILES notation of 4-Methyl-2-{3-[(pyridin-4-yloxy)methyl]piperidin-1-yl}pyrimidine is Cc1ccnc(N2CCCC(COc3ccncc3)C2)n1. |