CID 145867864
Modify Date: 2025-09-05 16:12:13
CID 145867864 structure
|
Common Name | CID 145867864 | ||
|---|---|---|---|---|
| CAS Number | 2379946-40-2 | Molecular Weight | 265.18 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H18Cl2N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | CID 145867864 |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H18Cl2N4 |
|---|---|
| Molecular Weight | 265.18 |
| InChIKey | KYVJHISOROHYBL-UHFFFAOYSA-N |
| SMILES | Cc1cnc(N(C)C2CCNC2)nc1.Cl.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of CID 145867864? |
| A: The English name of CID 145867864 is CID 145867864. |
| Q: What is the Chinese name of 2379946-40-2? |
| A: Chinese name of 2379946-40-2 is 2379946-40-2. |
| Q: What is the molecular formula of CID 145867864? |
| A: Molecular formula of CID 145867864 is C10H18Cl2N4. |
| Q: What is the molecular weight of CID 145867864? |
| A: Molecular weight of CID 145867864 is 265.18. |
| Q: What is the InChIKey of CID 145867864? |
| A: InChIKey of CID 145867864 is KYVJHISOROHYBL-UHFFFAOYSA-N. |
| Q: What is the CAS number of CID 145867864? |
| A: CAS number of CID 145867864 is 2379946-40-2. |
| Q: What is the SMILES notation of CID 145867864? |
| A: SMILES notation of CID 145867864 is Cc1cnc(N(C)C2CCNC2)nc1.Cl.Cl. |