Alletorphine
Modify Date: 2025-08-22 11:16:52
Alletorphine structure
|
Common Name | Alletorphine | ||
|---|---|---|---|---|
| CAS Number | 23758-80-7 | Molecular Weight | 437.57100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H35NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Alletorphine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C27H35NO4 |
|---|---|
| Molecular Weight | 437.57100 |
| Exact Mass | 437.25700 |
| PSA | 62.16000 |
| LogP | 3.65770 |
| Index of Refraction | 1.642 |
| InChIKey | OSQIRUUENNTOQL-PMEKXCSPSA-N |
| SMILES | C=CCN1CCC23c4c5ccc(O)c4OC2C2(OC)C=CC3(CC2C(C)(O)CCC)C1C5 |
|
~%
Alletorphine CAS#:23758-80-7 |
| Literature: Bentley,K.W.; Hardy,D.G. Journal of the American Chemical Society, 1967 , vol. 89, p. 3281 - 3292 |
| allethorphine |
| N-Allyletorphine |
| S-218M |