methyl phosphorylcholine structure
|
Common Name | methyl phosphorylcholine | ||
|---|---|---|---|---|
| CAS Number | 2375-06-6 | Molecular Weight | 197.16900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H16NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-(trimethylazaniumyl)ethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H16NO4P |
|---|---|
| Molecular Weight | 197.16900 |
| Exact Mass | 197.08200 |
| PSA | 68.40000 |
| LogP | 0.89420 |
| InChIKey | UFOVZASHPZGDNP-UHFFFAOYSA-N |
| SMILES | COP(=O)([O-])OCC[N+](C)(C)C |
| HS Code | 2923900090 |
|---|
|
~%
methyl phosphor... CAS#:2375-06-6 |
| Literature: Cheah; Watkins Journal of medicinal chemistry, 1965 , vol. 8, # 6 p. 821 - 824 |
|
~%
methyl phosphor... CAS#:2375-06-6 |
| Literature: Chabrier,P. et al. Comptes Rendus des Seances de l'Academie des Sciences, Serie C: Sciences Chimiques, 1968 , vol. 267, p. 732 - 734 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2923900090 |
|---|---|
| Summary | 2923900090 other quaternary ammonium salts and hydroxides。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hydroxide methyl hydrogen phosphate innersalt |
| methyl 2-trimethylammonio-ethyl phosphate |
| Methyl-<2-trimethyl-ammonio-aethyl>-phosphat |
| methylphosphocholine |
| Ammonium (2-hydroxyethyl) |
| Phosphorylcholine methyl ester |
| Methyl-2-(N,N,N-trimethylammonio)ethylphosphat |
| methylphosphorylcholine |