Carbanilic acid,p-(trifluoromethyl)-, isopropyl ester (8CI)
Modify Date: 2025-08-25 18:03:25
Carbanilic acid,p-(trifluoromethyl)-, isopropyl ester (8CI) structure
|
Common Name | Carbanilic acid,p-(trifluoromethyl)-, isopropyl ester (8CI) | ||
|---|---|---|---|---|
| CAS Number | 23745-45-1 | Molecular Weight | 247.21400 | |
| Density | 1.262g/cm3 | Boiling Point | 235.4ºC at 760 mmHg | |
| Molecular Formula | C11H12F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.2ºC | |
| Name | propan-2-yl N-[4-(trifluoromethyl)phenyl]carbamate |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 235.4ºC at 760 mmHg |
| Molecular Formula | C11H12F3NO2 |
| Molecular Weight | 247.21400 |
| Flash Point | 96.2ºC |
| Exact Mass | 247.08200 |
| PSA | 38.33000 |
| LogP | 3.73530 |
| Vapour Pressure | 0.0501mmHg at 25°C |
| Index of Refraction | 1.488 |
| InChIKey | LOEODQQLAPJDEP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)Nc1ccc(C(F)(F)F)cc1 |
| HS Code | 2924299090 |
|---|
|
~%
Carbanilic acid... CAS#:23745-45-1 |
| Literature: CIBA Ltd. Patent: DE1802739 , 1969 ; Chem.Abstr., 1969 , vol. 71, # 91056 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |