2-(bromomethyl)buta-1,3-diene
Modify Date: 2024-01-02 11:20:03
2-(bromomethyl)buta-1,3-diene structure
|
Common Name | 2-(bromomethyl)buta-1,3-diene | ||
|---|---|---|---|---|
| CAS Number | 23691-13-6 | Molecular Weight | 147.01300 | |
| Density | 1.286g/cm3 | Boiling Point | 132.7ºC at 760mmHg | |
| Molecular Formula | C5H7Br | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 30.5ºC | |
| Name | 2-(bromomethyl)buta-1,3-diene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286g/cm3 |
|---|---|
| Boiling Point | 132.7ºC at 760mmHg |
| Molecular Formula | C5H7Br |
| Molecular Weight | 147.01300 |
| Flash Point | 30.5ºC |
| Exact Mass | 145.97300 |
| LogP | 2.12350 |
| Vapour Pressure | 10.7mmHg at 25°C |
| Index of Refraction | 1.476 |
| HS Code | 2903399090 |
|---|
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,3-Butadiene,2-(bromomethyl) |
| 2-bromomethyl-buta-1,3-diene |
| 2-bromomethyl-1,3-butadiene |
| InChI=1/C5H7Br/c1-3-5(2)4-6/h3H,1-2,4H2 |
| KWEFLUDPRLSSTJ-UHFFFAOYSA |
| 2-Brommethyl-buta-1,3-dien |