1,3,5-tribromo-2,4,6-trifluoro-benzene structure
|
Common Name | 1,3,5-tribromo-2,4,6-trifluoro-benzene | ||
|---|---|---|---|---|
| CAS Number | 2368-49-2 | Molecular Weight | 368.77100 | |
| Density | 2.448g/cm3 | Boiling Point | 226.6ºC at 760mmHg | |
| Molecular Formula | C6Br3F3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.9ºC | |
| Name | 1,3,5-tribromo-2,4,6-trifluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.448g/cm3 |
|---|---|
| Boiling Point | 226.6ºC at 760mmHg |
| Molecular Formula | C6Br3F3 |
| Molecular Weight | 368.77100 |
| Flash Point | 90.9ºC |
| Exact Mass | 365.75000 |
| LogP | 4.39140 |
| Vapour Pressure | 0.122mmHg at 25°C |
| Index of Refraction | 1.568 |
| InChIKey | QKWXXOBRXUWWSG-UHFFFAOYSA-N |
| SMILES | Fc1c(Br)c(F)c(Br)c(F)c1Br |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3,5-Trifluor-2,4,6-tribrom-benzol |
| 1,3,5-Tribrom-2,4,6-trifluor-benzol |
| 1,3,5-Trifluoro-2,4,6-tribromobenzene |
| Benzene,1,3,5-tribromo-2,4,6-trifluoro |
| 1,3,5-tribromotrifluorobenzene |
| 1,3,5-TRIBROMO-2,4,6-TRIFLUORO-BENZENE |