N-(4-methylphenyl)-3-piperidin-1-ylpropanamide structure
|
Common Name | N-(4-methylphenyl)-3-piperidin-1-ylpropanamide | ||
|---|---|---|---|---|
| CAS Number | 23656-68-0 | Molecular Weight | 246.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(4-methylphenyl)-3-piperidin-1-ylpropanamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H22N2O |
|---|---|
| Molecular Weight | 246.34800 |
| Exact Mass | 246.17300 |
| PSA | 32.34000 |
| LogP | 2.82040 |
| InChIKey | QOEOJNGBKNJIGK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)CCN2CCCCC2)cc1 |
|
~%
N-(4-methylphen... CAS#:23656-68-0 |
| Literature: Brzezinski, Bogumil Polish Journal of Chemistry, 1983 , vol. 57, # 1-3 p. 249 - 252 |
|
~%
N-(4-methylphen... CAS#:23656-68-0 |
| Literature: Brzezinski, Bogumil Polish Journal of Chemistry, 1983 , vol. 57, # 1-3 p. 249 - 252 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-Piperidin-1-yl-N-p-tolyl-propionamide |