2-(4-nitrophenoxy)-1,3,2λ5-dioxaphosphinane 2-oxide
Modify Date: 2025-11-26 16:36:46
2-(4-nitrophenoxy)-1,3,2λ5-dioxaphosphinane 2-oxide structure
|
Common Name | 2-(4-nitrophenoxy)-1,3,2λ5-dioxaphosphinane 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 2365-54-0 | Molecular Weight | 259.15300 | |
| Density | 1.46g/cm3 | Boiling Point | 353.4ºC at 760mmHg | |
| Molecular Formula | C9H10NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.5ºC | |
| Name | 2-(4-nitrophenoxy)-1,3,2λ5-dioxaphosphinane 2-oxide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.46g/cm3 |
|---|---|
| Boiling Point | 353.4ºC at 760mmHg |
| Molecular Formula | C9H10NO6P |
| Molecular Weight | 259.15300 |
| Flash Point | 167.5ºC |
| Exact Mass | 259.02500 |
| PSA | 100.39000 |
| LogP | 3.04180 |
| Vapour Pressure | 7.31E-05mmHg at 25°C |
| Index of Refraction | 1.551 |
| InChIKey | UKSOBVMJOUMHAV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OP2(=O)OCCCO2)cc1 |
|
~43%
2-(4-nitropheno... CAS#:2365-54-0 |
| Literature: Lavey, Brian J.; Janda, Kim D. Journal of Organic Chemistry, 1996 , vol. 61, # 21 p. 7633 - 7636 |
|
~%
2-(4-nitropheno... CAS#:2365-54-0 |
| Literature: Fukuto,T.R.; Metcalf,R.L. Journal of Medicinal Chemistry, 1965 , vol. 8, p. 759 - 762 |
| 2-<4-Nitro-phenoxy>-1,3,2-dioxaphosphorinan-2-oxid |
| 2-(4-nitrophenoxy)-1,3,2 |
| 1,3,2-Dioxaphosphorinane,2-(4-nitrophenoxy)-,2-oxide |
| 2-(4-Nitrophenoxy)-1,3,2-dioxaphosphorinane 2-oxide |