tert-butyl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate structure
|
Common Name | tert-butyl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 236406-40-9 | Molecular Weight | 330.464 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 428.9±38.0 °C at 760 mmHg | |
| Molecular Formula | C20H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.2±26.8 °C | |
| Name | tert-butyl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.9±38.0 °C at 760 mmHg |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.464 |
| Flash Point | 213.2±26.8 °C |
| Exact Mass | 330.230713 |
| PSA | 32.78000 |
| LogP | 3.28 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.564 |
| InChIKey | FEUXMFWOKQLQBR-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCN(Cc3ccccc3)C2)CC1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,8-Diazaspiro[4.5]decane-8-carboxylic acid, 2-(phenylmethyl)-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate |
| tert-butyl 2-benzyl-2,8-diazaspiro[4.5]decane-8-carboxylate |