6-fluoro-5-nitroquinoline
Modify Date: 2025-08-25 10:40:15
6-fluoro-5-nitroquinoline structure
|
Common Name | 6-fluoro-5-nitroquinoline | ||
|---|---|---|---|---|
| CAS Number | 236092-96-9 | Molecular Weight | 192.14700 | |
| Density | 1.446 | Boiling Point | 338.4ºC at 760 mmHg | |
| Molecular Formula | C9H5FN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.5ºC | |
| Name | 6-fluoro-5-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446 |
|---|---|
| Boiling Point | 338.4ºC at 760 mmHg |
| Molecular Formula | C9H5FN2O2 |
| Molecular Weight | 192.14700 |
| Flash Point | 158.5ºC |
| Exact Mass | 192.03400 |
| PSA | 58.71000 |
| LogP | 2.80530 |
| Vapour Pressure | 0.000193mmHg at 25°C |
| Index of Refraction | 1.654 |
| InChIKey | LXLFTPABKFODKX-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(F)ccc2ncccc12 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoline,6-fluoro-5-nitro |