1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethanone structure
|
Common Name | 1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 23592-79-2 | Molecular Weight | 332.39200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4-methoxyphenyl)-2-(4-phenylmethoxyphenyl)ethanone |
|---|
| Molecular Formula | C22H20O3 |
|---|---|
| Molecular Weight | 332.39200 |
| Exact Mass | 332.14100 |
| PSA | 35.53000 |
| LogP | 4.69960 |
| InChIKey | UOCZCOBACJVUHH-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)Cc2ccc(OCc3ccccc3)cc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~%
1-(4-methoxyphe... CAS#:23592-79-2 |
| Literature: Poirier, Donald; Auger, Serge; Merand, Yves; Simard, Jacques; Labrie, Fernand Journal of Medicinal Chemistry, 1994 , vol. 37, # 8 p. 1115 - 1125 |
|
~%
1-(4-methoxyphe... CAS#:23592-79-2 |
| Literature: Poirier, Donald; Auger, Serge; Merand, Yves; Simard, Jacques; Labrie, Fernand Journal of Medicinal Chemistry, 1994 , vol. 37, # 8 p. 1115 - 1125 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |