Bis-PEG1-C-PEG1-CH2COOH
Modify Date: 2025-08-26 23:26:24
Bis-PEG1-C-PEG1-CH2COOH structure
|
Common Name | Bis-PEG1-C-PEG1-CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 2358775-67-2 | Molecular Weight | 350.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Bis-PEG1-C-PEG1-CH2COOHPROTAC Linker 26 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 26 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| Name | PROTAC Linker 26 |
|---|
| Description | PROTAC Linker 26 is a PROTAC linker, which refers to the alkyl/ether composition. PROTAC Linker 26 can be used in the synthesis of a series of PROTACs. PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl/ether |
| References |
| Molecular Formula | C16H30O8 |
|---|---|
| Molecular Weight | 350.40 |
| InChIKey | OAISFDJULXOPPD-UHFFFAOYSA-N |
| SMILES | O=C(O)COCCCCCOCCOCCCCCOCC(=O)O |
| Storage condition | -20°C |